Organic acids and derivatives
Filtered Search Results
Diisopropyl methylphosphonate, 95%, Thermo Scientific Chemicals
CAS: 1445-75-6 Molecular Formula: C7H17O3P Molecular Weight (g/mol): 180.18 MDL Number: MFCD00015022 InChI Key: WOAFDHWYKSOANX-UHFFFAOYSA-N Synonym: diisopropyl methylphosphonate,diisopropyl methanephosphonate,bis 1-methylethyl methylphosphonate,unii-56v3og5dc7,methylphosphonic acid diisopropyl ester,phosphonic acid, methyl-, bis 1-methylethyl ester,phosphonic acid, methyl-, diisopropyl ester,methylphosphonic acid bis 1-methylethyl ester,dsstox_cid_4051,dsstox_rid_77269 PubChem CID: 3073 ChEBI: CHEBI:77325 IUPAC Name: 2-[methyl(propan-2-yloxy)phosphoryl]oxypropane SMILES: CC(C)OP(C)(=O)OC(C)C
| PubChem CID | 3073 |
|---|---|
| CAS | 1445-75-6 |
| Molecular Weight (g/mol) | 180.18 |
| ChEBI | CHEBI:77325 |
| MDL Number | MFCD00015022 |
| SMILES | CC(C)OP(C)(=O)OC(C)C |
| Synonym | diisopropyl methylphosphonate,diisopropyl methanephosphonate,bis 1-methylethyl methylphosphonate,unii-56v3og5dc7,methylphosphonic acid diisopropyl ester,phosphonic acid, methyl-, bis 1-methylethyl ester,phosphonic acid, methyl-, diisopropyl ester,methylphosphonic acid bis 1-methylethyl ester,dsstox_cid_4051,dsstox_rid_77269 |
| IUPAC Name | 2-[methyl(propan-2-yloxy)phosphoryl]oxypropane |
| InChI Key | WOAFDHWYKSOANX-UHFFFAOYSA-N |
| Molecular Formula | C7H17O3P |
Ethyl cinnamate, 98+%
CAS: 103-36-6 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.215 MDL Number: MFCD00009189 InChI Key: KBEBGUQPQBELIU-CMDGGOBGSA-N Synonym: ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate PubChem CID: 637758 ChEBI: CHEBI:4895 IUPAC Name: ethyl (E)-3-phenylprop-2-enoate SMILES: CCOC(=O)C=CC1=CC=CC=C1
| PubChem CID | 637758 |
|---|---|
| CAS | 103-36-6 |
| Molecular Weight (g/mol) | 176.215 |
| ChEBI | CHEBI:4895 |
| MDL Number | MFCD00009189 |
| SMILES | CCOC(=O)C=CC1=CC=CC=C1 |
| Synonym | ethyl cinnamate,ethyl 3-phenylacrylate,ethylcinnamate,cinnamic acid ethyl ester,ethylcinnamoate,cinnamic acid, ethyl ester,ethyl trans-cinnamate,e-ethyl cinnamate,ethyl 3-phenyl-2-propenoate,ethyl benzylideneacetate |
| IUPAC Name | ethyl (E)-3-phenylprop-2-enoate |
| InChI Key | KBEBGUQPQBELIU-CMDGGOBGSA-N |
| Molecular Formula | C11H12O2 |
2,2'-Azino-bis(3-ethylbenzothiazoline-6-sulfonic acid) diammonium salt, 98%
CAS: 30931-67-0 Molecular Formula: C18H24N6O6S4 Molecular Weight (g/mol): 548.67 MDL Number: MFCD00010404,MFCD00010404 InChI Key: OHDRQQURAXLVGJ-AXMZSLBLSA-N Synonym: ammonium 2,2'-hydrazine-1,2-diylidene bis 3-ethyl-2,3-dihydrobenzo d thiazole-6-sulfonate PubChem CID: 91884754 IUPAC Name: diazanium;3-ethyl-2-[(E)-(3-ethyl-6-sulfonato-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate SMILES: [NH4+].[NH4+].CCN1\C(SC2=CC(=CC=C12)S([O-])(=O)=O)=N\N=C1/SC2=CC(=CC=C2N1CC)S([O-])(=O)=O
| PubChem CID | 91884754 |
|---|---|
| CAS | 30931-67-0 |
| Molecular Weight (g/mol) | 548.67 |
| MDL Number | MFCD00010404,MFCD00010404 |
| SMILES | [NH4+].[NH4+].CCN1\C(SC2=CC(=CC=C12)S([O-])(=O)=O)=N\N=C1/SC2=CC(=CC=C2N1CC)S([O-])(=O)=O |
| Synonym | ammonium 2,2'-hydrazine-1,2-diylidene bis 3-ethyl-2,3-dihydrobenzo d thiazole-6-sulfonate |
| IUPAC Name | diazanium;3-ethyl-2-[(E)-(3-ethyl-6-sulfonato-1,3-benzothiazol-2-ylidene)hydrazinylidene]-1,3-benzothiazole-6-sulfonate |
| InChI Key | OHDRQQURAXLVGJ-AXMZSLBLSA-N |
| Molecular Formula | C18H24N6O6S4 |
Taurine, 99%
CAS: 107-35-7 Molecular Formula: C2H7NO3S Molecular Weight (g/mol): 125.14 MDL Number: MFCD00008197 InChI Key: XOAAWQZATWQOTB-UHFFFAOYSA-N Synonym: taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid PubChem CID: 1123 ChEBI: CHEBI:15891 IUPAC Name: 2-aminoethanesulfonic acid SMILES: NCCS(O)(=O)=O
| PubChem CID | 1123 |
|---|---|
| CAS | 107-35-7 |
| Molecular Weight (g/mol) | 125.14 |
| ChEBI | CHEBI:15891 |
| MDL Number | MFCD00008197 |
| SMILES | NCCS(O)(=O)=O |
| Synonym | taurine,tauphon,ethanesulfonic acid, 2-amino,l-taurine,2-aminoethylsulfonic acid,o-due,2-sulfoethylamine,taufon,aminoethanesulfonic acid,aminoethylsulfonic acid |
| IUPAC Name | 2-aminoethanesulfonic acid |
| InChI Key | XOAAWQZATWQOTB-UHFFFAOYSA-N |
| Molecular Formula | C2H7NO3S |
Sodium 1-heptanesulfonate, 99% (dry wt.), water <2%
CAS: 22767-50-6 Molecular Formula: C7H15NaO3S Molecular Weight (g/mol): 202.244 MDL Number: MFCD00007543 InChI Key: REFMEZARFCPESH-UHFFFAOYSA-M Synonym: sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate PubChem CID: 23672332 IUPAC Name: sodium;heptane-1-sulfonate SMILES: CCCCCCCS(=O)(=O)[O-].[Na+]
| PubChem CID | 23672332 |
|---|---|
| CAS | 22767-50-6 |
| Molecular Weight (g/mol) | 202.244 |
| MDL Number | MFCD00007543 |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Synonym | sodium 1-heptanesulfonate,sodium heptane-1-sulfonate,1-heptanesulfonic acid sodium salt,1-heptanesulfonic acid, sodium salt,sodium heptane-1-sulphonate,1-heptanesulfonic acid, sodium salt 1:1,1-heptanesulfonic acid sodium,sodium heptanesulfonate,1-heptylsodiumsulfonate,sodium heptane sulfonate |
| IUPAC Name | sodium;heptane-1-sulfonate |
| InChI Key | REFMEZARFCPESH-UHFFFAOYSA-M |
| Molecular Formula | C7H15NaO3S |
Beta-Sitosterol From Soybeans Practical MP Biomedicals
CAS: 83-46-5 Molecular Formula: C29H50O Molecular Weight (g/mol): 414.718 InChI Key: KZJWDPNRJALLNS-VJSFXXLFSA-N Synonym: beta-sitosterol,sitosterol,cupreol,quebrachol,22,23-dihydrostigmasterol,azuprostat,triastonal,cinchol,rhamnol,harzol PubChem CID: 222284 ChEBI: CHEBI:27693 IUPAC Name: (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol SMILES: CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C
| PubChem CID | 222284 |
|---|---|
| CAS | 83-46-5 |
| Molecular Weight (g/mol) | 414.718 |
| ChEBI | CHEBI:27693 |
| SMILES | CCC(CCC(C)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O)C)C)C(C)C |
| Synonym | beta-sitosterol,sitosterol,cupreol,quebrachol,22,23-dihydrostigmasterol,azuprostat,triastonal,cinchol,rhamnol,harzol |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI Key | KZJWDPNRJALLNS-VJSFXXLFSA-N |
| Molecular Formula | C29H50O |
Sodium formate, ACS reagent
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.01 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.01 |
| ChEBI | CHEBI:62965 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
n-Butyl acetate, HPLC Grade, 99.5+%
CAS: 123-86-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009445 InChI Key: DKPFZGUDAPQIHT-UHFFFAOYSA-N Synonym: n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle PubChem CID: 31272 ChEBI: CHEBI:31328 IUPAC Name: butyl acetate SMILES: CCCCOC(C)=O
| PubChem CID | 31272 |
|---|---|
| CAS | 123-86-4 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:31328 |
| MDL Number | MFCD00009445 |
| SMILES | CCCCOC(C)=O |
| Synonym | n-butyl acetate,acetic acid, butyl ester,1-butyl acetate,butyl ethanoate,acetic acid butyl ester,n-butyl ethanoate,n-butylacetate,butylacetat,acetic acid n-butyl ester,acetate de butyle |
| IUPAC Name | butyl acetate |
| InChI Key | DKPFZGUDAPQIHT-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
O-Phosphorylethanolamine, 98%
CAS: 1071-23-4 Molecular Formula: C2H8NO4P Molecular Weight (g/mol): 141.06 MDL Number: MFCD00008178 InChI Key: SUHOOTKUPISOBE-UHFFFAOYSA-N Synonym: o-phosphoethanolamine,o-phosphorylethanolamine,phosphoethanolamine,o-phosphocolamine,colamine phosphate,phosphorylethanolamine,ethanolamine phosphate,phosphonoethanolamine,ethanolamine o-phosphate,mono 2-aminoethyl phosphate PubChem CID: 1015 ChEBI: CHEBI:17553 IUPAC Name: 2-aminoethyl dihydrogen phosphate SMILES: C(COP(=O)(O)O)N
| PubChem CID | 1015 |
|---|---|
| CAS | 1071-23-4 |
| Molecular Weight (g/mol) | 141.06 |
| ChEBI | CHEBI:17553 |
| MDL Number | MFCD00008178 |
| SMILES | C(COP(=O)(O)O)N |
| Synonym | o-phosphoethanolamine,o-phosphorylethanolamine,phosphoethanolamine,o-phosphocolamine,colamine phosphate,phosphorylethanolamine,ethanolamine phosphate,phosphonoethanolamine,ethanolamine o-phosphate,mono 2-aminoethyl phosphate |
| IUPAC Name | 2-aminoethyl dihydrogen phosphate |
| InChI Key | SUHOOTKUPISOBE-UHFFFAOYSA-N |
| Molecular Formula | C2H8NO4P |
Ethyl heptanoate, 98+%
CAS: 106-30-9 Molecular Formula: C9H18O2 Molecular Weight (g/mol): 158.24 MDL Number: MFCD00009538 InChI Key: TVQGDYNRXLTQAP-UHFFFAOYSA-N Synonym: ethyl enanthate,oenanthic ether,wine oil,ethyl heptylate,grape oil,ethyl heptoate,heptanoic acid, ethyl ester,cognac oil,enanthylic ether,ethyl oenanthate PubChem CID: 7797 ChEBI: CHEBI:86618 IUPAC Name: ethyl heptanoate SMILES: CCCCCCC(=O)OCC
| PubChem CID | 7797 |
|---|---|
| CAS | 106-30-9 |
| Molecular Weight (g/mol) | 158.24 |
| ChEBI | CHEBI:86618 |
| MDL Number | MFCD00009538 |
| SMILES | CCCCCCC(=O)OCC |
| Synonym | ethyl enanthate,oenanthic ether,wine oil,ethyl heptylate,grape oil,ethyl heptoate,heptanoic acid, ethyl ester,cognac oil,enanthylic ether,ethyl oenanthate |
| IUPAC Name | ethyl heptanoate |
| InChI Key | TVQGDYNRXLTQAP-UHFFFAOYSA-N |
| Molecular Formula | C9H18O2 |
Ethyl isobutyrate, 98%
CAS: 97-62-1 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009165 InChI Key: WDAXFOBOLVPGLV-UHFFFAOYSA-N Synonym: ethyl isobutyrate,ethyl isobutanoate,ethylisobutyrate,isobutyric acid ethyl ester,ethyl 2,2-dimethylacetate,propanoic acid, 2-methyl-, ethyl ester,isobutyric acid, ethyl ester,ethyl 2-methylpropionate,propionic acid, 2-methyl-, ethyl ester,ethyl isobutyrate natural PubChem CID: 7342 ChEBI: CHEBI:87303 IUPAC Name: ethyl 2-methylpropanoate SMILES: CCOC(=O)C(C)C
| PubChem CID | 7342 |
|---|---|
| CAS | 97-62-1 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:87303 |
| MDL Number | MFCD00009165 |
| SMILES | CCOC(=O)C(C)C |
| Synonym | ethyl isobutyrate,ethyl isobutanoate,ethylisobutyrate,isobutyric acid ethyl ester,ethyl 2,2-dimethylacetate,propanoic acid, 2-methyl-, ethyl ester,isobutyric acid, ethyl ester,ethyl 2-methylpropionate,propionic acid, 2-methyl-, ethyl ester,ethyl isobutyrate natural |
| IUPAC Name | ethyl 2-methylpropanoate |
| InChI Key | WDAXFOBOLVPGLV-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
1-Butanesulfonic acid, sodium salt, 98%
CAS: 2386-54-1 Molecular Formula: C4H9NaO3S Molecular Weight (g/mol): 160.16 MDL Number: MFCD00007540 InChI Key: XQCHMGAOAWZUPI-UHFFFAOYSA-M Synonym: sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot PubChem CID: 4096517 IUPAC Name: sodium;butane-1-sulfonate SMILES: [Na+].CCCCS([O-])(=O)=O
| PubChem CID | 4096517 |
|---|---|
| CAS | 2386-54-1 |
| Molecular Weight (g/mol) | 160.16 |
| MDL Number | MFCD00007540 |
| SMILES | [Na+].CCCCS([O-])(=O)=O |
| Synonym | sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot |
| IUPAC Name | sodium;butane-1-sulfonate |
| InChI Key | XQCHMGAOAWZUPI-UHFFFAOYSA-M |
| Molecular Formula | C4H9NaO3S |
Methylenediphosphonic acid, 98+%
CAS: 1984-15-2 Molecular Formula: CH6O6P2 Molecular Weight (g/mol): 176.00 MDL Number: MFCD00002139 InChI Key: MBKDYNNUVRNNRF-UHFFFAOYSA-N Synonym: methylenediphosphonic acid,medronic acid,acido medronico,methylene diphosphonate,acide medronique,acidum medronicum,phosphonic acid, methylenebis,methylenebis phosphonic acid,mdp-bracco,methanediphosphonic acid PubChem CID: 16124 ChEBI: CHEBI:43945 IUPAC Name: (phosphonomethyl)phosphonic acid SMILES: OP(O)(=O)CP(O)(O)=O
| PubChem CID | 16124 |
|---|---|
| CAS | 1984-15-2 |
| Molecular Weight (g/mol) | 176.00 |
| ChEBI | CHEBI:43945 |
| MDL Number | MFCD00002139 |
| SMILES | OP(O)(=O)CP(O)(O)=O |
| Synonym | methylenediphosphonic acid,medronic acid,acido medronico,methylene diphosphonate,acide medronique,acidum medronicum,phosphonic acid, methylenebis,methylenebis phosphonic acid,mdp-bracco,methanediphosphonic acid |
| IUPAC Name | (phosphonomethyl)phosphonic acid |
| InChI Key | MBKDYNNUVRNNRF-UHFFFAOYSA-N |
| Molecular Formula | CH6O6P2 |
2-Ethylhexyl methacrylate, 98%, stab. with 4-methoxyphenol
CAS: 688-84-6 Molecular Formula: C12H22O2 Molecular Weight (g/mol): 198.306 MDL Number: MFCD00009494 InChI Key: WDQMWEYDKDCEHT-UHFFFAOYSA-N Synonym: 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 PubChem CID: 12713 IUPAC Name: 2-ethylhexyl 2-methylprop-2-enoate SMILES: CCCCC(CC)COC(=O)C(=C)C
| PubChem CID | 12713 |
|---|---|
| CAS | 688-84-6 |
| Molecular Weight (g/mol) | 198.306 |
| MDL Number | MFCD00009494 |
| SMILES | CCCCC(CC)COC(=O)C(=C)C |
| Synonym | 2-ethylhexyl methacrylate,2-ethyl-1-hexyl methacrylate,2-ethylhexyl methacryate,2-propenoic acid, 2-methyl-, 2-ethylhexyl ester,methacrylic acid 2-ethylhexyl ester,methacrylic acid, 2-ethylhexyl ester,methacrylate, 2-ethylisohexy,2-ethylhexylmethacrylate,dsstox_cid_7293,dsstox_rid_78391 |
| IUPAC Name | 2-ethylhexyl 2-methylprop-2-enoate |
| InChI Key | WDQMWEYDKDCEHT-UHFFFAOYSA-N |
| Molecular Formula | C12H22O2 |
3-Nitrophenylboronic acid, 97%
CAS: 13331-27-6 Molecular Formula: C6H6BNO4 Molecular Weight (g/mol): 166.93 MDL Number: MFCD00007193 InChI Key: ZNRGSYUVFVNSAW-UHFFFAOYSA-N Synonym: 3-nitrophenyl boronic acid,3-nitrobenzeneboronic acid,m-nitrophenylboronic acid,boronic acid, 3-nitrophenyl,m-nitrobenzeneboronic acid,benzeneboronic acid, m-nitro,nitrophenylboronic acid,m-nitophenyl boronic acid,3-nitrophenyl boranediol PubChem CID: 1677 IUPAC Name: (3-nitrophenyl)boronic acid SMILES: OB(O)C1=CC=CC(=C1)[N+]([O-])=O
| PubChem CID | 1677 |
|---|---|
| CAS | 13331-27-6 |
| Molecular Weight (g/mol) | 166.93 |
| MDL Number | MFCD00007193 |
| SMILES | OB(O)C1=CC=CC(=C1)[N+]([O-])=O |
| Synonym | 3-nitrophenyl boronic acid,3-nitrobenzeneboronic acid,m-nitrophenylboronic acid,boronic acid, 3-nitrophenyl,m-nitrobenzeneboronic acid,benzeneboronic acid, m-nitro,nitrophenylboronic acid,m-nitophenyl boronic acid,3-nitrophenyl boranediol |
| IUPAC Name | (3-nitrophenyl)boronic acid |
| InChI Key | ZNRGSYUVFVNSAW-UHFFFAOYSA-N |
| Molecular Formula | C6H6BNO4 |